N-benzyloxycarbonyl-L-aspartic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

N-benzyloxycarbonyl-L-aspartic acid; (2S)-2-(phenylmethoxycarbonylamino)butanedioic acid; N-Z-L-aspartic acid
CAS RN:[1152-61-0]
Formula:C12H13NO6; 267.24 g/mol
InChiKey:XYXYXSKSTZAEJW-UHFFFAOYSA-N
SMILES:OC(=O)CC(NC(=O)OCc1ccccc1)C(O)=O
Molecular structure of N-benzyloxycarbonyl-L-aspartic acid
Melting point:118 °C

Isomers

N-benzyloxycarbonyl-L-aspartic acid
Molecular structure of N-benzyloxycarbonyl-L-aspartic acid
3-hydroxy-3-(phenylcarbamoyl)pentanedioic acid
Molecular structure of 3-hydroxy-3-(phenylcarbamoyl)pentanedioic acid
3-nitrophthalic acid 2-butyl ester
Molecular structure of 3-nitrophthalic acid 2-butyl ester
3-nitrophthalic acid 2-isobutyl ester
Molecular structure of 3-nitrophthalic acid 2-isobutyl ester
  ::     ::   Zla Mavka